Products 2422029-01-2
CAS 2422029-01-2 is the registry number for (2,4,6-Trifluorobenzene-1,3,5-triyl)trimethanamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[3,5-bis(aminomethyl)-2,4,6-trifluorophenyl]methanamine (CAS 2422029-01-2) is a chemical compound with the molecular formula C9H12F3N3 and a molecular weight of 219.21 g/mol. IUPAC name: [3,5-bis(aminomethyl)-2,4,6-trifluorophenyl]methanamine. InChIKey: AEMASZJQYBESBD-UHFFFAOYSA-N.
| Molecular formula | C9H12F3N3 |
|---|---|
| Molecular weight | 219.21 g/mol |
| IUPAC name | [3,5-bis(aminomethyl)-2,4,6-trifluorophenyl]methanamine |
| InChIKey | AEMASZJQYBESBD-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)CN)F)CN)F)N |
Computed by PubChem (NCBI)