CAS 2422046-29-3 is the registry number for 2,4-Dichloro-6-(3-(triphenylsilyl)phenyl)-1,3,5-triazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[3-(4,6-dichloro-1,3,5-triazin-2-yl)phenyl]-triphenylsilane (CAS 2422046-29-3) is a chemical compound with the molecular formula C27H19Cl2N3Si and a molecular weight of 484.4 g/mol. IUPAC name: [3-(4,6-dichloro-1,3,5-triazin-2-yl)phenyl]-triphenylsilane. InChIKey: WTAXWESWQDFTDT-UHFFFAOYSA-N.
| Molecular formula | C27H19Cl2N3Si |
|---|---|
| Molecular weight | 484.4 g/mol |
| IUPAC name | [3-(4,6-dichloro-1,3,5-triazin-2-yl)phenyl]-triphenylsilane |
| InChIKey | WTAXWESWQDFTDT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC(=C4)C5=NC(=NC(=N5)Cl)Cl |
Computed by PubChem (NCBI)