CAS 2422110-20-9 is the registry number for 5-Bromo-N-(tert-butyldimethylsilyl)thiophene-2-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-[tert-butyl(dimethyl)silyl]thiophene-2-sulfonamide (CAS 2422110-20-9) is a chemical compound with the molecular formula C10H18BrNO2S2Si and a molecular weight of 356.4 g/mol. IUPAC name: 5-bromo-N-[tert-butyl(dimethyl)silyl]thiophene-2-sulfonamide. InChIKey: KMRVWOGMARHDNE-UHFFFAOYSA-N.
| Molecular formula | C10H18BrNO2S2Si |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 5-bromo-N-[tert-butyl(dimethyl)silyl]thiophene-2-sulfonamide |
| InChIKey | KMRVWOGMARHDNE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)NS(=O)(=O)C1=CC=C(S1)Br |
Computed by PubChem (NCBI)