CAS 24234-92-2 appears in our catalog under these names: N-(4-Chloro-2-(2-chlorobenzoyl)phenyl)-2-((2-hydroxyethyl)amino)acetamide, >95% (HPLC), Cloxazolam Impurity B. Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, 10mg, 25mg, on request.
N-[4-chloro-2-(2-chlorobenzoyl)phenyl]-2-(2-hydroxyethylamino)acetamide (CAS 24234-92-2) is a chemical compound with the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.2 g/mol. IUPAC name: N-[4-chloro-2-(2-chlorobenzoyl)phenyl]-2-(2-hydroxyethylamino)acetamide. InChIKey: PIJVIEBVNDIKTA-UHFFFAOYSA-N.
| Molecular formula | C17H16Cl2N2O3 |
|---|---|
| Molecular weight | 367.2 g/mol |
| IUPAC name | N-[4-chloro-2-(2-chlorobenzoyl)phenyl]-2-(2-hydroxyethylamino)acetamide |
| InChIKey | PIJVIEBVNDIKTA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)Cl)NC(=O)CNCCO)Cl |
Computed by PubChem (NCBI)