CAS 24239-82-5 appears in our catalog under these names: 1,5–Dibromo–2,4–dinitrobenzene, 1,5-Dibromo-2,4-dinitrobenzene 97%, 1,3-Dibromo-4,6-dinitrobenzene, 97%, 97%, 1,5-DIBROMO-2,4-DINITROBENZENE, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g.
1,5-dibromo-2,4-dinitrobenzene (CAS 24239-82-5) is a chemical compound with the molecular formula C6H2Br2N2O4 and a molecular weight of 325.90 g/mol. IUPAC name: 1,5-dibromo-2,4-dinitrobenzene. InChIKey: HYQUWYMJSAPGDY-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2N2O4 |
|---|---|
| Molecular weight | 325.90 g/mol |
| IUPAC name | 1,5-dibromo-2,4-dinitrobenzene |
| InChIKey | HYQUWYMJSAPGDY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)