Products 242487-82-7
CAS 242487-82-7 appears in our catalog under these names: S1R agonist 1 hydrochloride, S1R agonist 1 hydrochloride, S1R agonist 1 (hydrochloride), 99.83%, 1-(2-Phenoxyethyl)-4-(phenylmethyl)piperidine hydrochloride, 95%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 10mg, 100mg, 25mg, 5mg, 50mg, 10 mg, 5 mg.
4-benzyl-1-(2-phenoxyethyl)piperidine;hydrochloride (CAS 242487-82-7) is a chemical compound with the molecular formula C20H26ClNO and a molecular weight of 331.9 g/mol. IUPAC name: 4-benzyl-1-(2-phenoxyethyl)piperidine;hydrochloride. InChIKey: ZMNFHWLFDVATLX-UHFFFAOYSA-N.
| Molecular formula | C20H26ClNO |
|---|---|
| Molecular weight | 331.9 g/mol |
| IUPAC name | 4-benzyl-1-(2-phenoxyethyl)piperidine;hydrochloride |
| InChIKey | ZMNFHWLFDVATLX-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CC2=CC=CC=C2)CCOC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)