Products 2426562-80-1
CAS 2426562-80-1 is the registry number for 1-Bromo-5-(trifluoromethyl)-2,3-dihydro-1H-indene, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-5-(trifluoromethyl)-2,3-dihydro-1H-indene (CAS 2426562-80-1) is a chemical compound with the molecular formula C10H8BrF3 and a molecular weight of 265.07 g/mol. IUPAC name: 1-bromo-5-(trifluoromethyl)-2,3-dihydro-1H-indene. InChIKey: MVTYNMMVNYOKSX-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3 |
|---|---|
| Molecular weight | 265.07 g/mol |
| IUPAC name | 1-bromo-5-(trifluoromethyl)-2,3-dihydro-1H-indene |
| InChIKey | MVTYNMMVNYOKSX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1Br)C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)