CAS 2426657-55-6 is the registry number for (S)-2-(2-(tert-Butoxy)-2-oxoethyl)-4,4,4-trifluorobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-4,4,4-trifluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]butanoic acid (CAS 2426657-55-6) is a chemical compound with the molecular formula C10H15F3O4 and a molecular weight of 256.22 g/mol. IUPAC name: (2S)-4,4,4-trifluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]butanoic acid. InChIKey: GCMQZOVVCDRYPU-LURJTMIESA-N.
| Molecular formula | C10H15F3O4 |
|---|---|
| Molecular weight | 256.22 g/mol |
| IUPAC name | (2S)-4,4,4-trifluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]butanoic acid |
| InChIKey | GCMQZOVVCDRYPU-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)