Products 2426657-70-5
CAS 2426657-70-5 is the registry number for (R)-4-(tert-Butoxy)-4-oxo-2-(2,3,4-trifluorobenzyl)butanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-[(2,3,4-trifluorophenyl)methyl]butanoic acid (CAS 2426657-70-5) is a chemical compound with the molecular formula C15H17F3O4 and a molecular weight of 318.29 g/mol. IUPAC name: (2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-[(2,3,4-trifluorophenyl)methyl]butanoic acid. InChIKey: CJCQRKSCYDJUMH-SECBINFHSA-N.
| Molecular formula | C15H17F3O4 |
|---|---|
| Molecular weight | 318.29 g/mol |
| IUPAC name | (2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-[(2,3,4-trifluorophenyl)methyl]butanoic acid |
| InChIKey | CJCQRKSCYDJUMH-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CC1=C(C(=C(C=C1)F)F)F)C(=O)O |
Computed by PubChem (NCBI)