CAS 2427483-03-0 is the registry number for tert-Butyl 4-((2S,3S)-2-amino-3-hydroxybutyl)piperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-[(2S,3S)-2-amino-3-hydroxybutyl]piperazine-1-carboxylate (CAS 2427483-03-0) is a chemical compound with the molecular formula C13H27N3O3 and a molecular weight of 273.37 g/mol. IUPAC name: tert-butyl 4-[(2S,3S)-2-amino-3-hydroxybutyl]piperazine-1-carboxylate. InChIKey: BBYXKMHTXZBQTQ-QWRGUYRKSA-N.
| Molecular formula | C13H27N3O3 |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | tert-butyl 4-[(2S,3S)-2-amino-3-hydroxybutyl]piperazine-1-carboxylate |
| InChIKey | BBYXKMHTXZBQTQ-QWRGUYRKSA-N |
| SMILES | C[C@@H]([C@H](CN1CCN(CC1)C(=O)OC(C)(C)C)N)O |
Computed by PubChem (NCBI)