CAS 242802-03-5 appears in our catalog under these names: Tegaserod Metabolite (SDZ 244-120), 1-(5-Methoxy-1H-Indole-3-carboxylate)-beta-D-glucopyranuronic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(5-methoxy-1H-indole-3-carbonyl)oxyoxane-2-carboxylic acid (CAS 242802-03-5) is a chemical compound with the molecular formula C16H17NO9 and a molecular weight of 367.31 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(5-methoxy-1H-indole-3-carbonyl)oxyoxane-2-carboxylic acid. InChIKey: BNGXEFQTQPJRBK-DJUFWWRVSA-N.
| Molecular formula | C16H17NO9 |
|---|---|
| Molecular weight | 367.31 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(5-methoxy-1H-indole-3-carbonyl)oxyoxane-2-carboxylic acid |
| InChIKey | BNGXEFQTQPJRBK-DJUFWWRVSA-N |
| SMILES | COC1=CC2=C(C=C1)NC=C2C(=O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O |
Computed by PubChem (NCBI)