Products 2428389-65-3
CAS 2428389-65-3 is the registry number for AChE-IN-20. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[4,6-bis(4-sulfamoylanilino)-1,3,5-triazin-2-yl]amino]benzoic acid (CAS 2428389-65-3) is a chemical compound with the molecular formula C22H20N8O6S2 and a molecular weight of 556.6 g/mol. IUPAC name: 4-[[4,6-bis(4-sulfamoylanilino)-1,3,5-triazin-2-yl]amino]benzoic acid. InChIKey: RNJQUZMSEZRHNH-UHFFFAOYSA-N.
| Molecular formula | C22H20N8O6S2 |
|---|---|
| Molecular weight | 556.6 g/mol |
| IUPAC name | 4-[[4,6-bis(4-sulfamoylanilino)-1,3,5-triazin-2-yl]amino]benzoic acid |
| InChIKey | RNJQUZMSEZRHNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NC2=NC(=NC(=N2)NC3=CC=C(C=C3)S(=O)(=O)N)NC4=CC=C(C=C4)S(=O)(=O)N |
Computed by PubChem (NCBI)
Synonyms:
AChE-IN-20, orb1686102