CAS 2428458-82-4 appears in our catalog under these names: Flusulfinam, >95% (HPLC), Flusulfinam. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 25mg, 50mg, 5mg, 10mg.
2-fluoro-N-(5-methyl-1,3,4-oxadiazol-2-yl)-3-propylsulfinyl-4-(trifluoromethyl)benzamide (CAS 2428458-82-4) is a chemical compound with the molecular formula C14H13F4N3O3S and a molecular weight of 379.33 g/mol. IUPAC name: 2-fluoro-N-(5-methyl-1,3,4-oxadiazol-2-yl)-3-propylsulfinyl-4-(trifluoromethyl)benzamide. InChIKey: PWQIRGHRDYHXJS-UHFFFAOYSA-N.
| Molecular formula | C14H13F4N3O3S |
|---|---|
| Molecular weight | 379.33 g/mol |
| IUPAC name | 2-fluoro-N-(5-methyl-1,3,4-oxadiazol-2-yl)-3-propylsulfinyl-4-(trifluoromethyl)benzamide |
| InChIKey | PWQIRGHRDYHXJS-UHFFFAOYSA-N |
| SMILES | CCCS(=O)C1=C(C=CC(=C1F)C(=O)NC2=NN=C(O2)C)C(F)(F)F |
Computed by PubChem (NCBI)