CAS 24305-63-3 appears in our catalog under these names: Glycidyl Linoleate, >95% (GC), Linoleic acid-glycidyl ester 100 µg/mL in Acetonitrile, Linoleic Acid glycidyl ester, Glycidyl linoleate. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 1ml, 1mg, 5mg, 1 mg, 5 mg.
Oxiran-2-ylmethyl (9Z,12Z)-octadeca-9,12-dienoate (CAS 24305-63-3) is a chemical compound with the molecular formula C21H36O3 and a molecular weight of 336.5 g/mol. IUPAC name: oxiran-2-ylmethyl (9Z,12Z)-octadeca-9,12-dienoate. InChIKey: LOGTZDQTPQYKEN-HZJYTTRNSA-N.
| Molecular formula | C21H36O3 |
|---|---|
| Molecular weight | 336.5 g/mol |
| IUPAC name | oxiran-2-ylmethyl (9Z,12Z)-octadeca-9,12-dienoate |
| InChIKey | LOGTZDQTPQYKEN-HZJYTTRNSA-N |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC1CO1 |
Computed by PubChem (NCBI)