CAS 24308-93-8 is the registry number for Baran nps reagent, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Zinc bis(propane-1-sulfinate) (CAS 24308-93-8) is a chemical compound with the molecular formula C6H14O4S2Zn and a molecular weight of 279.7 g/mol. IUPAC name: zinc bis(propane-1-sulfinate). InChIKey: AVEWLRYVGNMIHD-UHFFFAOYSA-L.
| Molecular formula | C6H14O4S2Zn |
|---|---|
| Molecular weight | 279.7 g/mol |
| IUPAC name | zinc bis(propane-1-sulfinate) |
| InChIKey | AVEWLRYVGNMIHD-UHFFFAOYSA-L |
| SMILES | CCCS(=O)[O-].CCCS(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)