CAS 24313-49-3 appears in our catalog under these names: 2-Pentanone-1,1,1,3,3-d5, 98 atom % D, min 98% Chemical Purity, 2–PENTANONE–1,1,1,3,3–D5. Offered by: CDN, GLPBio. Available pack sizes: 1g, 0,5g, 10mg.
1,1,1,3,3-pentadeuteriopentan-2-one (CAS 24313-49-3) is a chemical compound with the molecular formula C5H10O and a molecular weight of 91.16 g/mol. IUPAC name: 1,1,1,3,3-pentadeuteriopentan-2-one. InChIKey: XNLICIUVMPYHGG-PVGOWFQYSA-N.
| Molecular formula | C5H10O |
|---|---|
| Molecular weight | 91.16 g/mol |
| IUPAC name | 1,1,1,3,3-pentadeuteriopentan-2-one |
| InChIKey | XNLICIUVMPYHGG-PVGOWFQYSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])CC |
Computed by PubChem (NCBI)