Products 24313-50-6
CAS 24313-50-6 appears in our catalog under these names: 2-Butanone-1,1,1,3,3-d5, 98 atom % D, min 98% Chemical Purity, 2-BUTANONE-1,1,1,3,3-D5, 98 ATOM % D. Offered by: CDN, Sigma-Aldrich. Available pack sizes: 1g, 5G.
1,1,1,3,3-pentadeuteriobutan-2-one (CAS 24313-50-6) is a chemical compound with the molecular formula C4H8O and a molecular weight of 77.14 g/mol. IUPAC name: 1,1,1,3,3-pentadeuteriobutan-2-one. InChIKey: ZWEHNKRNPOVVGH-PDWRLMEDSA-N.
| Molecular formula | C4H8O |
|---|---|
| Molecular weight | 77.14 g/mol |
| IUPAC name | 1,1,1,3,3-pentadeuteriobutan-2-one |
| InChIKey | ZWEHNKRNPOVVGH-PDWRLMEDSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])C |
Computed by PubChem (NCBI)