CAS 24314-35-0 is the registry number for 1,4-Bis(4-chlorophenyl)butane-1,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-bis(4-chlorophenyl)butane-1,4-dione (CAS 24314-35-0) is a chemical compound with the molecular formula C16H12Cl2O2 and a molecular weight of 307.2 g/mol. IUPAC name: 1,4-bis(4-chlorophenyl)butane-1,4-dione. InChIKey: JPFNKZZXDRISQH-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2O2 |
|---|---|
| Molecular weight | 307.2 g/mol |
| IUPAC name | 1,4-bis(4-chlorophenyl)butane-1,4-dione |
| InChIKey | JPFNKZZXDRISQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CCC(=O)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)