CAS 2431996-89-1 is the registry number for Ethyl (1S,2S)-2-(4-acetyl-3-fluorophenyl)cyclopropane-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-ethyl (1S,2S)-2-(4-acetyl-3-fluorophenyl)cyclopropane-1-carboxylate (CAS 2431996-89-1) is a chemical compound with the molecular formula C14H15FO3 and a molecular weight of 250.26 g/mol. IUPAC name: trans-ethyl (1S,2S)-2-(4-acetyl-3-fluorophenyl)cyclopropane-1-carboxylate. InChIKey: YHFORNIKHOFQEZ-NEPJUHHUSA-N.
| Molecular formula | C14H15FO3 |
|---|---|
| Molecular weight | 250.26 g/mol |
| IUPAC name | trans-ethyl (1S,2S)-2-(4-acetyl-3-fluorophenyl)cyclopropane-1-carboxylate |
| InChIKey | YHFORNIKHOFQEZ-NEPJUHHUSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@@H]1C2=CC(=C(C=C2)C(=O)C)F |
Computed by PubChem (NCBI)