CAS 2432-03-3 appears in our catalog under these names: 4-Bromo-2,6-diisopropylphenol, 95%, 4-Bromo-2,6-diisopropylphenol, 98%, 98%, 4-Bromo-2,6-diisopropylphenol, 98%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-bromo-2,6-di(propan-2-yl)phenol (CAS 2432-03-3) is a chemical compound with the molecular formula C12H17BrO and a molecular weight of 257.17 g/mol. IUPAC name: 4-bromo-2,6-di(propan-2-yl)phenol. InChIKey: QNJVELOLCDKQBN-UHFFFAOYSA-N.
| Molecular formula | C12H17BrO |
|---|---|
| Molecular weight | 257.17 g/mol |
| IUPAC name | 4-bromo-2,6-di(propan-2-yl)phenol |
| InChIKey | QNJVELOLCDKQBN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1O)C(C)C)Br |
Computed by PubChem (NCBI)