Products 2432-87-3
CAS 2432-87-3 appears in our catalog under these names: Dioctyl decanedioate, 98%, Di–n–octyl sebacate, Di-n-octyl sebacate, Di-n-octyl Sebacate, >95.0%(GC), Di-n-Octyl Sebacate, 98%, 98%. Offered by: AmBeed, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 5g, 100g, 500g, 50g, 25ml, 10g, 1x100mg.
Dioctyl decanedioate (CAS 2432-87-3) is a chemical compound with the molecular formula C26H50O4 and a molecular weight of 426.7 g/mol. IUPAC name: dioctyl decanedioate. InChIKey: MIMDHDXOBDPUQW-UHFFFAOYSA-N.
| Molecular formula | C26H50O4 |
|---|---|
| Molecular weight | 426.7 g/mol |
| IUPAC name | dioctyl decanedioate |
| InChIKey | MIMDHDXOBDPUQW-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)CCCCCCCCC(=O)OCCCCCCCC |
Computed by PubChem (NCBI)
Synonyms:
Di-n-octyl sebacate, Dioctyl sebacate, Dioctyl decanedioate, Decanedioic acid, dioctyl ester, Witamol 500, Sebacic acid, dioctyl ester, Bis(2-ethylhexyl) ester, decanedionic acid, Bis(2-ethylhexyl) ester, sebacic acid, Bis-(2-ethylhexyl)ester kyseliny sebakove, Bis-(2-ethylhexyl)ester kyseliny sebakove [Czech]