CAS 24325-23-3 is the registry number for ((2R,3S,4R)-3,4,5-Trihydroxytetrahydrofuran-2-yl)methyl Barium Phosphate. Offered by: TRC. Available pack sizes: 25mg.
Barium(2+);4-hydroxy-5-(phosphonooxymethyl)oxolane-2,3-diolate (CAS 24325-23-3) is a chemical compound with the molecular formula C5H9BaO8P and a molecular weight of 365.42 g/mol. IUPAC name: barium(2+);4-hydroxy-5-(phosphonooxymethyl)oxolane-2,3-diolate. InChIKey: VXAHXRNHRUSACE-UHFFFAOYSA-N.
| Molecular formula | C5H9BaO8P |
|---|---|
| Molecular weight | 365.42 g/mol |
| IUPAC name | barium(2+);4-hydroxy-5-(phosphonooxymethyl)oxolane-2,3-diolate |
| InChIKey | VXAHXRNHRUSACE-UHFFFAOYSA-N |
| SMILES | C(C1C(C(C(O1)[O-])[O-])O)OP(=O)(O)O.[Ba+2] |
Computed by PubChem (NCBI)