CAS 24326-09-8 appears in our catalog under these names: Methyl L-alanyl-L-alaninate, Ala-Ala-OMe. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
Methyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate (CAS 24326-09-8) is a chemical compound with the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. IUPAC name: methyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate. InChIKey: LNLRCQQTGATDQI-WHFBIAKZSA-N.
| Molecular formula | C7H14N2O3 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | methyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate |
| InChIKey | LNLRCQQTGATDQI-WHFBIAKZSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)OC)N |
Computed by PubChem (NCBI)