Products 2432829-49-5
CAS 2432829-49-5 is the registry number for Rel-(1s,3s)-3-(4-bromo-1H-pyrazol-1-yl)-1-methylcyclobutan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromopyrazol-1-yl)-1-methylcyclobutan-1-ol (CAS 2432829-49-5) is a chemical compound with the molecular formula C8H11BrN2O and a molecular weight of 231.09 g/mol. IUPAC name: 3-(4-bromopyrazol-1-yl)-1-methylcyclobutan-1-ol. InChIKey: GJZKPWCXCWEWIE-UHFFFAOYSA-N.
| Molecular formula | C8H11BrN2O |
|---|---|
| Molecular weight | 231.09 g/mol |
| IUPAC name | 3-(4-bromopyrazol-1-yl)-1-methylcyclobutan-1-ol |
| InChIKey | GJZKPWCXCWEWIE-UHFFFAOYSA-N |
| SMILES | CC1(CC(C1)N2C=C(C=N2)Br)O |
Computed by PubChem (NCBI)