CAS 2432848-98-9 is the registry number for (4,6-Dibromo-2-fluoro-3-methoxyphenyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
(4,6-dibromo-2-fluoro-3-methoxyphenyl)methanol (CAS 2432848-98-9) is a chemical compound with the molecular formula C8H7Br2FO2 and a molecular weight of 313.95 g/mol. IUPAC name: (4,6-dibromo-2-fluoro-3-methoxyphenyl)methanol. InChIKey: DDWOLTIIPBPPFC-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2FO2 |
|---|---|
| Molecular weight | 313.95 g/mol |
| IUPAC name | (4,6-dibromo-2-fluoro-3-methoxyphenyl)methanol |
| InChIKey | DDWOLTIIPBPPFC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1F)CO)Br)Br |
Computed by PubChem (NCBI)