Products 2432849-16-4
CAS 2432849-16-4 is the registry number for (3-(Benzyloxy)-2-bromo-6-fluorophenyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
(2-bromo-6-fluoro-3-phenylmethoxyphenyl)methanol (CAS 2432849-16-4) is a chemical compound with the molecular formula C14H12BrFO2 and a molecular weight of 311.15 g/mol. IUPAC name: (2-bromo-6-fluoro-3-phenylmethoxyphenyl)methanol. InChIKey: FCJUZORDBGZJRT-UHFFFAOYSA-N.
| Molecular formula | C14H12BrFO2 |
|---|---|
| Molecular weight | 311.15 g/mol |
| IUPAC name | (2-bromo-6-fluoro-3-phenylmethoxyphenyl)methanol |
| InChIKey | FCJUZORDBGZJRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)CO)Br |
Computed by PubChem (NCBI)