CAS 24339-58-0 appears in our catalog under these names: 2,3,4,5-Tetrabromoaniline, 2,3,4,5-tetrabromoaniline, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g.
2,3,4,5-tetrabromoaniline (CAS 24339-58-0) is a chemical compound with the molecular formula C6H3Br4N and a molecular weight of 408.71 g/mol. IUPAC name: 2,3,4,5-tetrabromoaniline. InChIKey: ZRLODVWGYJSMCP-UHFFFAOYSA-N.
| Molecular formula | C6H3Br4N |
|---|---|
| Molecular weight | 408.71 g/mol |
| IUPAC name | 2,3,4,5-tetrabromoaniline |
| InChIKey | ZRLODVWGYJSMCP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)Br)Br)N |
Computed by PubChem (NCBI)