CAS 24345-02-6 is the registry number for Zinc(II) 4-methylbenzenesulfinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Zinc bis(4-methylbenzenesulfinate) (CAS 24345-02-6) is a chemical compound with the molecular formula C14H14O4S2Zn and a molecular weight of 375.8 g/mol. IUPAC name: zinc bis(4-methylbenzenesulfinate). InChIKey: KHYUFILZGMOXBR-UHFFFAOYSA-L.
| Molecular formula | C14H14O4S2Zn |
|---|---|
| Molecular weight | 375.8 g/mol |
| IUPAC name | zinc bis(4-methylbenzenesulfinate) |
| InChIKey | KHYUFILZGMOXBR-UHFFFAOYSA-L |
| SMILES | CC1=CC=C(C=C1)S(=O)[O-].CC1=CC=C(C=C1)S(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)