CAS 24345-74-2 appears in our catalog under these names: 1,5-Diazido-3-oxapentane, Azido-PEG1-azide/ min. 98%, Azido–PEG1–azide, Azido-PEG1-azide, 99.11%, Azido-PEG1-azide, 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 500mg, 10mg, 100mg, 50mg, 250mg, 1000mg, 100 mg.
1-azido-2-(2-azidoethoxy)ethane (CAS 24345-74-2) is a chemical compound with the molecular formula C4H8N6O and a molecular weight of 156.15 g/mol. IUPAC name: 1-azido-2-(2-azidoethoxy)ethane. InChIKey: NQEPBRYUGPSVPU-UHFFFAOYSA-N.
| Molecular formula | C4H8N6O |
|---|---|
| Molecular weight | 156.15 g/mol |
| IUPAC name | 1-azido-2-(2-azidoethoxy)ethane |
| InChIKey | NQEPBRYUGPSVPU-UHFFFAOYSA-N |
| SMILES | C(COCCN=[N+]=[N-])N=[N+]=[N-] |
Computed by PubChem (NCBI)