CAS 243472-73-3 is the registry number for 2-Bromo-3,5,6-triphenylpyrazine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-3,5,6-triphenylpyrazine (CAS 243472-73-3) is a chemical compound with the molecular formula C22H15BrN2 and a molecular weight of 387.3 g/mol. IUPAC name: 2-bromo-3,5,6-triphenylpyrazine. InChIKey: VWNDZXYWEVLZRV-UHFFFAOYSA-N.
| Molecular formula | C22H15BrN2 |
|---|---|
| Molecular weight | 387.3 g/mol |
| IUPAC name | 2-bromo-3,5,6-triphenylpyrazine |
| InChIKey | VWNDZXYWEVLZRV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(C(=N2)C3=CC=CC=C3)Br)C4=CC=CC=C4 |
Computed by PubChem (NCBI)