CAS 2435-53-2 appears in our catalog under these names: o-Chloranil, Tetrachloro–o–benzoquinone, o-Chloranil, >97.0%(HPLC)(T), Tetrachloro-o-benzoquinone, 97%, 3,4,5,6-Tetrachloro-1,2-benzoquinone 97%. Offered by: TRC, GLPBio, Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: 10g, 1g, 25g, 5g, 50g, 100g, 100mg, 250mg.
3,4,5,6-tetrachlorocyclohexa-3,5-diene-1,2-dione (CAS 2435-53-2) is a chemical compound with the molecular formula C6Cl4O2 and a molecular weight of 245.9 g/mol. IUPAC name: 3,4,5,6-tetrachlorocyclohexa-3,5-diene-1,2-dione. InChIKey: VRGCYEIGVVTZCC-UHFFFAOYSA-N.
| Molecular formula | C6Cl4O2 |
|---|---|
| Molecular weight | 245.9 g/mol |
| IUPAC name | 3,4,5,6-tetrachlorocyclohexa-3,5-diene-1,2-dione |
| InChIKey | VRGCYEIGVVTZCC-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=O)C(=O)C(=C1Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)