CAS 2435-54-3 is the registry number for 3,4,5,6-Tetrabromocyclohexa-3,5-diene-1,2-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4,5,6-tetrabromocyclohexa-3,5-diene-1,2-dione (CAS 2435-54-3) is a chemical compound with the molecular formula C6Br4O2 and a molecular weight of 423.68 g/mol. IUPAC name: 3,4,5,6-tetrabromocyclohexa-3,5-diene-1,2-dione. InChIKey: DXKHBLYQXDEINJ-UHFFFAOYSA-N.
| Molecular formula | C6Br4O2 |
|---|---|
| Molecular weight | 423.68 g/mol |
| IUPAC name | 3,4,5,6-tetrabromocyclohexa-3,5-diene-1,2-dione |
| InChIKey | DXKHBLYQXDEINJ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=O)C(=O)C(=C1Br)Br)Br)Br |
Computed by PubChem (NCBI)