CAS 2436275-33-9 appears in our catalog under these names: Canagliflozin Impurity 21, Canagliflozin Impurity 99. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene (CAS 2436275-33-9) is a chemical compound with the molecular formula C18H14FIS and a molecular weight of 408.3 g/mol. IUPAC name: 2-(2-fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene. InChIKey: CFXOLHKQEVNOBB-UHFFFAOYSA-N.
| Molecular formula | C18H14FIS |
|---|---|
| Molecular weight | 408.3 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene |
| InChIKey | CFXOLHKQEVNOBB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)I)CC2=CC=C(S2)C3=CC=CC=C3F |
Computed by PubChem (NCBI)