CAS 2436275-53-3 is the registry number for (R)-3-amino-9-fluoro-5-phenyl-1H-benzo[e][1,4]diazepin-2(3H)-one, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3R)-3-amino-9-fluoro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 2436275-53-3) is a chemical compound with the molecular formula C15H12FN3O and a molecular weight of 269.27 g/mol. IUPAC name: (3R)-3-amino-9-fluoro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: WIORTIPKQQCZHO-CQSZACIVSA-N.
| Molecular formula | C15H12FN3O |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | (3R)-3-amino-9-fluoro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | WIORTIPKQQCZHO-CQSZACIVSA-N |
| SMILES | C1=CC=C(C=C1)C2=N[C@H](C(=O)NC3=C2C=CC=C3F)N |
Computed by PubChem (NCBI)