CAS 2436296-64-7 is the registry number for (5-Bromo-1H-indazol-3-yl)methanamine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(5-bromo-2H-indazol-3-yl)methanamine;hydrochloride (CAS 2436296-64-7) is a chemical compound with the molecular formula C8H9BrClN3 and a molecular weight of 262.53 g/mol. IUPAC name: (5-bromo-2H-indazol-3-yl)methanamine;hydrochloride. InChIKey: TZCSBNYRVWHFHY-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClN3 |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | (5-bromo-2H-indazol-3-yl)methanamine;hydrochloride |
| InChIKey | TZCSBNYRVWHFHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C=C1Br)CN.Cl |
Computed by PubChem (NCBI)