CAS 243659-12-3 is the registry number for 5-Methyl-3-(perfluorooctyl)pyrazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-5-methyl-1H-pyrazole (CAS 243659-12-3) is a chemical compound with the molecular formula C12H5F17N2 and a molecular weight of 500.15 g/mol. IUPAC name: 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-5-methyl-1H-pyrazole. InChIKey: ZZAFDXWUOUYUMN-UHFFFAOYSA-N.
| Molecular formula | C12H5F17N2 |
|---|---|
| Molecular weight | 500.15 g/mol |
| IUPAC name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-5-methyl-1H-pyrazole |
| InChIKey | ZZAFDXWUOUYUMN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)