CAS 243664-15-5 appears in our catalog under these names: 1,3–dimethylimidazolium hexafluorophosphate, 1,3-dimethylimidazolium hexafluorophosphate 99%, 1,3-dimethylimidazolium hexafluorophosphate, 99%, 99%, 1,3-dimethylimidazolium hexafluorophosphate, 99%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g.
1,3-dimethylimidazol-1-ium hexafluorophosphate (CAS 243664-15-5) is a chemical compound with the molecular formula C5H9F6N2P and a molecular weight of 242.10 g/mol. IUPAC name: 1,3-dimethylimidazol-1-ium hexafluorophosphate. InChIKey: GHHQXGQUBHYUSO-UHFFFAOYSA-N.
| Molecular formula | C5H9F6N2P |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 1,3-dimethylimidazol-1-ium hexafluorophosphate |
| InChIKey | GHHQXGQUBHYUSO-UHFFFAOYSA-N |
| SMILES | CN1C=C[N+](=C1)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)