CAS 2436720-45-3 is the registry number for 2-(2-Bromo-5-methoxyphenyl)ethan-1-ol, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-bromo-10-methoxy-6,6-dimethylnaphtho[3,2-b][1]benzofuran-11-one (CAS 2436720-45-3) is a chemical compound with the molecular formula C19H15BrO3 and a molecular weight of 371.2 g/mol. IUPAC name: 3-bromo-10-methoxy-6,6-dimethylnaphtho[3,2-b][1]benzofuran-11-one. InChIKey: UKKMKBGKFGPLNY-UHFFFAOYSA-N.
| Molecular formula | C19H15BrO3 |
|---|---|
| Molecular weight | 371.2 g/mol |
| IUPAC name | 3-bromo-10-methoxy-6,6-dimethylnaphtho[3,2-b][1]benzofuran-11-one |
| InChIKey | UKKMKBGKFGPLNY-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=CC=C2)OC)C(=O)C3=C1OC4=C3C=CC(=C4)Br)C |
Computed by PubChem (NCBI)