Products 2436762-80-8

CAS 2436762-80-8 is the registry number for Cinacalcet Hydrochloride impurity III, 98%, 98%. Offered by: Chemat. Available pack sizes: 5mg.

Structural formula: {0} (CAS {1})

N-[(1R)-1-naphthalen-1-ylethyl]-3-[2-(trifluoromethyl)phenyl]propanamide (CAS 2436762-80-8) is a chemical compound with the molecular formula C22H20F3NO and a molecular weight of 371.4 g/mol. IUPAC name: N-[(1R)-1-naphthalen-1-ylethyl]-3-[2-(trifluoromethyl)phenyl]propanamide. InChIKey: FHSPBYOZSISQHU-OAHLLOKOSA-N.

Identity
Molecular formulaC22H20F3NO
Molecular weight371.4 g/mol
IUPAC nameN-[(1R)-1-naphthalen-1-ylethyl]-3-[2-(trifluoromethyl)phenyl]propanamide
InChIKeyFHSPBYOZSISQHU-OAHLLOKOSA-N
SMILESC[C@H](C1=CC=CC2=CC=CC=C21)NC(=O)CCC3=CC=CC=C3C(F)(F)F

Computed by PubChem (NCBI)