CAS 2437650-82-1 is the registry number for 6-Benzyl-5-methyl-2-morpholin-4-yl[1,2,4]triazolo[1,5-a]pyrimidin-7(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-benzyl-5-methyl-2-morpholin-4-yl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 2437650-82-1) is a chemical compound with the molecular formula C17H19N5O2 and a molecular weight of 325.4 g/mol. IUPAC name: 6-benzyl-5-methyl-2-morpholin-4-yl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: XLAJBEVSFPOSES-UHFFFAOYSA-N.
| Molecular formula | C17H19N5O2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 6-benzyl-5-methyl-2-morpholin-4-yl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | XLAJBEVSFPOSES-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C(=N1)N=C(N2)N3CCOCC3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)