CAS 2437650-83-2 is the registry number for 6-Fluoro-2,2,4-trimethyl-4-phenyl-1,2,3,4-tetrahydroquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-fluoro-2,2,4-trimethyl-4-phenyl-1,3-dihydroquinoline (CAS 2437650-83-2) is a chemical compound with the molecular formula C18H20FN and a molecular weight of 269.4 g/mol. IUPAC name: 6-fluoro-2,2,4-trimethyl-4-phenyl-1,3-dihydroquinoline. InChIKey: KSOWYPQKVFXVFI-UHFFFAOYSA-N.
| Molecular formula | C18H20FN |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | 6-fluoro-2,2,4-trimethyl-4-phenyl-1,3-dihydroquinoline |
| InChIKey | KSOWYPQKVFXVFI-UHFFFAOYSA-N |
| SMILES | CC1(CC(C2=C(N1)C=CC(=C2)F)(C)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)