Products 2438-03-1

CAS 2438-03-1 is the registry number for 2-Propylbenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.

Structural formula: {0} (CAS {1})

2-propylbenzoic acid (CAS 2438-03-1) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: 2-propylbenzoic acid. InChIKey: GADSJKKDLMALGL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O2
Molecular weight164.20 g/mol
IUPAC name2-propylbenzoic acid
InChIKeyGADSJKKDLMALGL-UHFFFAOYSA-N
SMILESCCCC1=CC=CC=C1C(=O)O

Computed by PubChem (NCBI)