CAS 2438-85-9 is the registry number for (4-Fluorophenyl)(4-nitrophenyl)sulfane, 95+%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
1-(4-fluorophenyl)sulfanyl-4-nitrobenzene (CAS 2438-85-9) is a chemical compound with the molecular formula C12H8FNO2S and a molecular weight of 249.26 g/mol. IUPAC name: 1-(4-fluorophenyl)sulfanyl-4-nitrobenzene. InChIKey: SORUMIWSFRGDCF-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO2S |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | 1-(4-fluorophenyl)sulfanyl-4-nitrobenzene |
| InChIKey | SORUMIWSFRGDCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])SC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)