Products 2438162-87-7
CAS 2438162-87-7 is the registry number for tert-Butyl (3-bromo-5-(trifluoromethoxy)phenyl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[3-bromo-5-(trifluoromethoxy)phenyl]carbamate (CAS 2438162-87-7) is a chemical compound with the molecular formula C12H13BrF3NO3 and a molecular weight of 356.14 g/mol. IUPAC name: tert-butyl N-[3-bromo-5-(trifluoromethoxy)phenyl]carbamate. InChIKey: LLOHORMSTXDZBX-UHFFFAOYSA-N.
| Molecular formula | C12H13BrF3NO3 |
|---|---|
| Molecular weight | 356.14 g/mol |
| IUPAC name | tert-butyl N-[3-bromo-5-(trifluoromethoxy)phenyl]carbamate |
| InChIKey | LLOHORMSTXDZBX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC(=C1)Br)OC(F)(F)F |
Computed by PubChem (NCBI)