Products 2438239-83-7
CAS 2438239-83-7 is the registry number for ABT-002. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindole-5-carboxylic acid (CAS 2438239-83-7) is a chemical compound with the molecular formula C14H11FN2O5 and a molecular weight of 306.25 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindole-5-carboxylic acid. InChIKey: OBCYSDKGKQWABZ-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2O5 |
|---|---|
| Molecular weight | 306.25 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindole-5-carboxylic acid |
| InChIKey | OBCYSDKGKQWABZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=CC(=C(C=C3C2=O)F)C(=O)O |
Computed by PubChem (NCBI)