Products 243857-26-3

CAS 243857-26-3 is the registry number for 2-(Aminomethyl)-3-methylbutanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-(aminomethyl)-3-methylbutanoic acid;hydrochloride (CAS 243857-26-3) is a chemical compound with the molecular formula C6H14ClNO2 and a molecular weight of 167.63 g/mol. IUPAC name: 2-(aminomethyl)-3-methylbutanoic acid;hydrochloride. InChIKey: VTSGJSAOJMRTGB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H14ClNO2
Molecular weight167.63 g/mol
IUPAC name2-(aminomethyl)-3-methylbutanoic acid;hydrochloride
InChIKeyVTSGJSAOJMRTGB-UHFFFAOYSA-N
SMILESCC(C)C(CN)C(=O)O.Cl

Computed by PubChem (NCBI)