Products 24388-68-9
CAS 24388-68-9 appears in our catalog under these names: PET Impurity 2, Ethylene Terephthalate Cyclic Dimer, >95% (HPLC), Ethylene terephthalate cyclic dimer-d8, Ethylene terephthalate cyclic dimer. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 2,5mg, 2mg, 5mg, 1 mg.
3,6,13,16-tetraoxatricyclo[16.2.2.28,11]tetracosa-1(21),8,10,18(22),19,23-hexaene-2,7,12,17-tetrone (CAS 24388-68-9) is a chemical compound with the molecular formula C20H16O8 and a molecular weight of 384.3 g/mol. IUPAC name: 3,6,13,16-tetraoxatricyclo[16.2.2.28,11]tetracosa-1(21),8,10,18(22),19,23-hexaene-2,7,12,17-tetrone. InChIKey: NFFNGYZBZAPKKE-UHFFFAOYSA-N.
| Molecular formula | C20H16O8 |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | 3,6,13,16-tetraoxatricyclo[16.2.2.28,11]tetracosa-1(21),8,10,18(22),19,23-hexaene-2,7,12,17-tetrone |
| InChIKey | NFFNGYZBZAPKKE-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C2=CC=C(C=C2)C(=O)OCCOC(=O)C3=CC=C(C=C3)C(=O)O1 |
Computed by PubChem (NCBI)
Synonyms:
Ethylene Terephthalate Cyclic Dimer, Ethylene Terephthalate Cyclic Dimer-d8, Benzoic Acid impurity 5, orb3144852, NFFNGYZBZAPKKE-UHFFFAOYSA-N, Ethylene glycol, bimol. cyclic terephthalate, Terephthalic acid, bimol. cyclic ethylene ester, 3,6,10,13-Tetraoxa-1,8(1,4)-dibenzenacyclotetradecaphane-2,7,9,14-tetraone