Products 2438900-74-2
CAS 2438900-74-2 is the registry number for tert-Butyl (S)-3-(5-oxo-4,5-dihydro-1H-1,2,4-triazol-3-yl)piperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3S)-3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)piperidine-1-carboxylate (CAS 2438900-74-2) is a chemical compound with the molecular formula C12H20N4O3 and a molecular weight of 268.31 g/mol. IUPAC name: tert-butyl (3S)-3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)piperidine-1-carboxylate. InChIKey: TWMWNGQCBFDESQ-QMMMGPOBSA-N.
| Molecular formula | C12H20N4O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | tert-butyl (3S)-3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)piperidine-1-carboxylate |
| InChIKey | TWMWNGQCBFDESQ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)C2=NNC(=O)N2 |
Computed by PubChem (NCBI)