CAS 129050-48-2 is the registry number for L-Histidyl-L-isoleucine. Offered by: TRC. Available pack sizes: 250mg.
His-Ile is a dipeptide obtained by formal condensation of the carboxy group of L-histidine with the amino group of L-isoleucine. It is functionally related to a L-histidine and a L-isoleucine.
Source: ChEBI
| Molecular formula | C12H20N4O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (2S,3S)-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoic acid |
| InChIKey | IDXZDKMBEXLFMB-HGNGGELXSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)NC(=O)[C@H](CC1=CN=CN1)N |
Computed by PubChem (NCBI)