Products 2439272-57-6
CAS 2439272-57-6 is the registry number for MAT2A-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(2-chlorophenyl)-7-cyclopropyl-4-(methylamino)quinazolin-2-one (CAS 2439272-57-6) is a chemical compound with the molecular formula C18H16ClN3O and a molecular weight of 325.8 g/mol. IUPAC name: 1-(2-chlorophenyl)-7-cyclopropyl-4-(methylamino)quinazolin-2-one. InChIKey: KQRIBGOBTCCQSR-UHFFFAOYSA-N.
| Molecular formula | C18H16ClN3O |
|---|---|
| Molecular weight | 325.8 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-7-cyclopropyl-4-(methylamino)quinazolin-2-one |
| InChIKey | KQRIBGOBTCCQSR-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=O)N(C2=C1C=CC(=C2)C3CC3)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)